C16H22O5 — CID 102063575
2-ethenyl-2-ethoxy-4-[(3-methoxyphenyl)methoxymethyl]-1,3-dioxolane (PubChem CID 102063575) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-ethenyl-2-ethoxy-4-[(3-methoxyphenyl)methoxymethyl]-1,3-dioxolane.
| Compound Name | 2-ethenyl-2-ethoxy-4-[(3-methoxyphenyl)methoxymethyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 102063575 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-ethenyl-2-ethoxy-4-[(3-methoxyphenyl)methoxymethyl]-1,3-dioxolane |
| SMILES | C=CC1(OCC)OCC(COCc2cccc(OC)c2)O1 |
| InChI | InChI=1S/C16H22O5/c1-4-16(19-5-2)20-12-15(21-16)11-18-10-13-7-6-8-14(9-13)17-3/h4,6-9,15H,1,5,10-12H2,2-3H3 |
| InChIKey | XQBFOWDKQOIWHN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|