C17H25BrO2 — CID 63468796
1-[[1-(bromomethyl)-4-ethylcyclohexyl]oxymethyl]-3-methoxybenzene (PubChem CID 63468796) has the molecular formula C17H25BrO2 and a molecular weight of 341.29 g/mol. Its IUPAC name is 1-[[1-(bromomethyl)-4-ethylcyclohexyl]oxymethyl]-3-methoxybenzene.
| Compound Name | 1-[[1-(bromomethyl)-4-ethylcyclohexyl]oxymethyl]-3-methoxybenzene |
|---|---|
| PubChem CID | 63468796 |
| Molecular Formula | C17H25BrO2 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1-[[1-(bromomethyl)-4-ethylcyclohexyl]oxymethyl]-3-methoxybenzene |
| SMILES | CCC1CCC(CBr)(OCc2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C17H25BrO2/c1-3-14-7-9-17(13-18,10-8-14)20-12-15-5-4-6-16(11-15)19-2/h4-6,11,14H,3,7-10,12-13H2,1-2H3 |
| InChIKey | LGBLFFADUYFJLX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|