C14H21FO7 — CID 102064281
[(2R,4aR,6S,7R,8S,8aR)-7-acetyloxy-6-fluoro-2-propyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 102064281) has the molecular formula C14H21FO7 and a molecular weight of 320.31 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8S,8aR)-7-acetyloxy-6-fluoro-2-propyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(2R,4aR,6S,7R,8S,8aR)-7-acetyloxy-6-fluoro-2-propyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 102064281 |
| Molecular Formula | C14H21FO7 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | [(2R,4aR,6S,7R,8S,8aR)-7-acetyloxy-6-fluoro-2-propyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CCC[C@@H]1OC[C@H]2O[C@@H](F)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2O1 |
| InChI | InChI=1S/C14H21FO7/c1-4-5-10-18-6-9-11(22-10)12(19-7(2)16)13(14(15)21-9)20-8(3)17/h9-14H,4-6H2,1-3H3/t9-,10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | GBYACBRFWJFFKX-YOVYLDAJSA-N |
| XLogP | 1.09 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |