C23H25O5P — CID 102064291
[(1Z,3E)-4-(5,5-dimethyl-2-oxido-1,3,2-dioxaphosphinan-2-ium-2-yl)-1,3-diphenylbuta-1,3-dien-2-yl] acetate (PubChem CID 102064291) has the molecular formula C23H25O5P and a molecular weight of 412.42 g/mol. Its IUPAC name is [(1Z,3E)-4-(5,5-dimethyl-2-oxido-1,3,2-dioxaphosphinan-2-ium-2-yl)-1,3-diphenylbuta-1,3-dien-2-yl] acetate.
| Compound Name | [(1Z,3E)-4-(5,5-dimethyl-2-oxido-1,3,2-dioxaphosphinan-2-ium-2-yl)-1,3-diphenylbuta-1,3-dien-2-yl] acetate |
|---|---|
| PubChem CID | 102064291 |
| Molecular Formula | C23H25O5P |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | [(1Z,3E)-4-(5,5-dimethyl-2-oxido-1,3,2-dioxaphosphinan-2-ium-2-yl)-1,3-diphenylbuta-1,3-dien-2-yl] acetate |
| SMILES | CC(=O)OC(=C\c1ccccc1)/C(=C/[P+]1([O-])OCC(C)(C)CO1)c1ccccc1 |
| InChI | InChI=1S/C23H25O5P/c1-18(24)28-22(14-19-10-6-4-7-11-19)21(20-12-8-5-9-13-20)15-29(25)26-16-23(2,3)17-27-29/h4-15H,16-17H2,1-3H3/b21-15+,22-14- |
| InChIKey | IDBFYPXSUAIRDX-JDOZLOAYSA-N |
| XLogP | 4.83 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|