C49H42O6 — CID 71769621
[(R)-[(4S,5S)-5-[(R)-[(E)-2,3-diphenylprop-2-enoyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethyl] (E)-2,3-diphenylprop-2-enoate (PubChem CID 71769621) has the molecular formula C49H42O6 and a molecular weight of 726.87 g/mol. Its IUPAC name is [(R)-[(4S,5S)-5-[(R)-[(E)-2,3-diphenylprop-2-enoyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethyl] (E)-2,3-diphenylprop-2-enoate.
| Compound Name | [(R)-[(4S,5S)-5-[(R)-[(E)-2,3-diphenylprop-2-enoyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethyl] (E)-2,3-diphenylprop-2-enoate |
|---|---|
| PubChem CID | 71769621 |
| Molecular Formula | C49H42O6 |
| Molecular Weight | 726.87 g/mol |
| Exact Mass | 726.30 |
| IUPAC Name | [(R)-[(4S,5S)-5-[(R)-[(E)-2,3-diphenylprop-2-enoyl]oxy-phenylmethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-phenylmethyl] (E)-2,3-diphenylprop-2-enoate |
| SMILES | CC1(C)O[C@@H]([C@H](OC(=O)/C(=C/c2ccccc2)c2ccccc2)c2ccccc2)[C@H]([C@H](OC(=O)/C(=C/c2ccccc2)c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C49H42O6/c1-49(2)54-45(43(39-29-17-7-18-30-39)52-47(50)41(37-25-13-5-14-26-37)33-35-21-9-3-10-22-35)46(55-49)44(40-31-19-8-20-32-40)53-48(51)42(38-27-15-6-16-28-38)34-36-23-11-4-12-24-36/h3-34,43-46H,1-2H3/b41-33+,42-34+/t43-,44-,45+,46+/m1/s1 |
| InChIKey | PKAUFKKFVBHYGO-UOPGBFFQSA-N |
| XLogP | 10.56 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.87 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|