C13H11F3O4 — CID 102380610
2,2,2-trifluoroethyl (Z)-2-acetyloxy-3-phenylprop-2-enoate (PubChem CID 102380610) has the molecular formula C13H11F3O4 and a molecular weight of 288.22 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (Z)-2-acetyloxy-3-phenylprop-2-enoate.
| Compound Name | 2,2,2-trifluoroethyl (Z)-2-acetyloxy-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 102380610 |
| Molecular Formula | C13H11F3O4 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2,2,2-trifluoroethyl (Z)-2-acetyloxy-3-phenylprop-2-enoate |
| SMILES | CC(=O)O/C(=C\c1ccccc1)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C13H11F3O4/c1-9(17)20-11(7-10-5-3-2-4-6-10)12(18)19-8-13(14,15)16/h2-7H,8H2,1H3/b11-7- |
| InChIKey | MJEWZXCVCPYURH-XFFZJAGNSA-N |
| XLogP | 2.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|