C22H16 — CID 102065231
9,10-dihydronaphtho[1,2-b]phenanthrene (PubChem CID 102065231) has the molecular formula C22H16 and a molecular weight of 280.37 g/mol. Its IUPAC name is 9,10-dihydronaphtho[1,2-b]phenanthrene.
| Compound Name | 9,10-dihydronaphtho[1,2-b]phenanthrene |
|---|---|
| PubChem CID | 102065231 |
| Molecular Formula | C22H16 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 9,10-dihydronaphtho[1,2-b]phenanthrene |
| SMILES | C1=c2ccc3cc4c(ccc5ccccc54)cc3c2=CCC1 |
| InChI | InChI=1S/C22H16/c1-3-7-19-15(5-1)9-11-17-14-22-18(13-21(17)19)12-10-16-6-2-4-8-20(16)22/h1,3,5-14H,2,4H2 |
| InChIKey | VNWJSGLHOQJPBP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|