C15H14S — CID 88940343
2,3-dihydroanthracen-9-ylmethanethiol (PubChem CID 88940343) has the molecular formula C15H14S and a molecular weight of 226.34 g/mol. Its IUPAC name is 2,3-dihydroanthracen-9-ylmethanethiol.
| Compound Name | 2,3-dihydroanthracen-9-ylmethanethiol |
|---|---|
| PubChem CID | 88940343 |
| Molecular Formula | C15H14S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2,3-dihydroanthracen-9-ylmethanethiol |
| SMILES | SCc1c2c(cc3ccccc13)=CCCC=2 |
| InChI | InChI=1S/C15H14S/c16-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15/h1,3,5-9,16H,2,4,10H2 |
| InChIKey | CRGLPQWOLWDIFS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|