C19H24 — CID 143572983
ethane;9-ethyl-2-methyl-2,3-dihydroanthracene (PubChem CID 143572983) has the molecular formula C19H24 and a molecular weight of 252.40 g/mol. Its IUPAC name is ethane;9-ethyl-2-methyl-2,3-dihydroanthracene.
| Compound Name | ethane;9-ethyl-2-methyl-2,3-dihydroanthracene |
|---|---|
| PubChem CID | 143572983 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | ethane;9-ethyl-2-methyl-2,3-dihydroanthracene |
| SMILES | CC.CCc1c2c(cc3ccccc13)=CCC(C)C=2 |
| InChI | InChI=1S/C17H18.C2H6/c1-3-15-16-7-5-4-6-13(16)11-14-9-8-12(2)10-17(14)15;1-2/h4-7,9-12H,3,8H2,1-2H3;1-2H3 |
| InChIKey | VARNRZMSZIWWAA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |