C15H18O2 — CID 102066020
(3aR,4R,7aS)-4-phenoxy-2,3,3a,4,5,6,7,7a-octahydroinden-1-one (PubChem CID 102066020) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (3aR,4R,7aS)-4-phenoxy-2,3,3a,4,5,6,7,7a-octahydroinden-1-one.
| Compound Name | (3aR,4R,7aS)-4-phenoxy-2,3,3a,4,5,6,7,7a-octahydroinden-1-one |
|---|---|
| PubChem CID | 102066020 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (3aR,4R,7aS)-4-phenoxy-2,3,3a,4,5,6,7,7a-octahydroinden-1-one |
| SMILES | O=C1CC[C@@H]2[C@@H]1CCC[C@H]2Oc1ccccc1 |
| InChI | InChI=1S/C15H18O2/c16-14-10-9-13-12(14)7-4-8-15(13)17-11-5-2-1-3-6-11/h1-3,5-6,12-13,15H,4,7-10H2/t12-,13+,15+/m0/s1 |
| InChIKey | YKTRWIUZOFWISM-GZBFAFLISA-N |
| XLogP | 3.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |