C26H23N3O3S2 — CID 10206619
5-[[4-[2-[1,3-benzothiazol-2-yl(benzyl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 10206619) has the molecular formula C26H23N3O3S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is 5-[[4-[2-[1,3-benzothiazol-2-yl(benzyl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-[1,3-benzothiazol-2-yl(benzyl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10206619 |
| Molecular Formula | C26H23N3O3S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 5-[[4-[2-[1,3-benzothiazol-2-yl(benzyl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc(OCCN(Cc3ccccc3)c3nc4ccccc4s3)cc2)S1 |
| InChI | InChI=1S/C26H23N3O3S2/c30-24-23(34-26(31)28-24)16-18-10-12-20(13-11-18)32-15-14-29(17-19-6-2-1-3-7-19)25-27-21-8-4-5-9-22(21)33-25/h1-13,23H,14-17H2,(H,28,30,31) |
| InChIKey | PGYRMYURHJSMQI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|