C27H48O8 — CID 102066213
ethyl (E,4R)-4-[(4S,5R)-5-[(11S)-11-acetyloxydodecyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)but-2-enoate (PubChem CID 102066213) has the molecular formula C27H48O8 and a molecular weight of 500.67 g/mol. Its IUPAC name is ethyl (E,4R)-4-[(4S,5R)-5-[(11S)-11-acetyloxydodecyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)but-2-enoate.
| Compound Name | ethyl (E,4R)-4-[(4S,5R)-5-[(11S)-11-acetyloxydodecyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)but-2-enoate |
|---|---|
| PubChem CID | 102066213 |
| Molecular Formula | C27H48O8 |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | ethyl (E,4R)-4-[(4S,5R)-5-[(11S)-11-acetyloxydodecyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)but-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](OCOC)[C@H]1OC(C)(C)O[C@@H]1CCCCCCCCCC[C@H](C)OC(C)=O |
| InChI | InChI=1S/C27H48O8/c1-7-31-25(29)19-18-23(32-20-30-6)26-24(34-27(4,5)35-26)17-15-13-11-9-8-10-12-14-16-21(2)33-22(3)28/h18-19,21,23-24,26H,7-17,20H2,1-6H3/b19-18+/t21-,23+,24+,26+/m0/s1 |
| InChIKey | PZTPHMWPHBAENJ-AVNRLBGZSA-N |
| XLogP | 5.47 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|