C15H28O5 — CID 134858907
[(2S)-7-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]heptan-2-yl] acetate (PubChem CID 134858907) has the molecular formula C15H28O5 and a molecular weight of 288.38 g/mol. Its IUPAC name is [(2S)-7-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]heptan-2-yl] acetate.
| Compound Name | [(2S)-7-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]heptan-2-yl] acetate |
|---|---|
| PubChem CID | 134858907 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | [(2S)-7-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]heptan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)CCCCC[C@H]1OC(C)(C)O[C@H]1CO |
| InChI | InChI=1S/C15H28O5/c1-11(18-12(2)17)8-6-5-7-9-13-14(10-16)20-15(3,4)19-13/h11,13-14,16H,5-10H2,1-4H3/t11-,13+,14-/m0/s1 |
| InChIKey | ZIUWYZOMIHSFNO-YUTCNCBUSA-N |
| XLogP | 2.40 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|