C19H22N2O9S — CID 102066582
methyl (2R,3S)-3-hydroxy-3-[4-(methoxymethoxy)phenyl]-2-[methyl-(4-nitrophenyl)sulfonylamino]propanoate (PubChem CID 102066582) has the molecular formula C19H22N2O9S and a molecular weight of 454.46 g/mol. Its IUPAC name is methyl (2R,3S)-3-hydroxy-3-[4-(methoxymethoxy)phenyl]-2-[methyl-(4-nitrophenyl)sulfonylamino]propanoate.
| Compound Name | methyl (2R,3S)-3-hydroxy-3-[4-(methoxymethoxy)phenyl]-2-[methyl-(4-nitrophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 102066582 |
| Molecular Formula | C19H22N2O9S |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | methyl (2R,3S)-3-hydroxy-3-[4-(methoxymethoxy)phenyl]-2-[methyl-(4-nitrophenyl)sulfonylamino]propanoate |
| SMILES | COCOc1ccc([C@H](O)[C@H](C(=O)OC)N(C)S(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C19H22N2O9S/c1-20(31(26,27)16-10-6-14(7-11-16)21(24)25)17(19(23)29-3)18(22)13-4-8-15(9-5-13)30-12-28-2/h4-11,17-18,22H,12H2,1-3H3/t17-,18+/m1/s1 |
| InChIKey | SKJZPHTZVOMTIJ-MSOLQXFVSA-N |
| XLogP | 1.47 |
| TPSA | 145.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|