C23H37N2O3P — CID 102070238
N-tert-butyl-N-[(4-cyanophenyl)methyl]-[(5-methyl-2-propan-2-ylcyclohexyl)methoxy]phosphonamidic acid (PubChem CID 102070238) has the molecular formula C23H37N2O3P and a molecular weight of 420.53 g/mol. Its IUPAC name is N-tert-butyl-N-[(4-cyanophenyl)methyl]-[(5-methyl-2-propan-2-ylcyclohexyl)methoxy]phosphonamidic acid.
| Compound Name | N-tert-butyl-N-[(4-cyanophenyl)methyl]-[(5-methyl-2-propan-2-ylcyclohexyl)methoxy]phosphonamidic acid |
|---|---|
| PubChem CID | 102070238 |
| Molecular Formula | C23H37N2O3P |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | N-tert-butyl-N-[(4-cyanophenyl)methyl]-[(5-methyl-2-propan-2-ylcyclohexyl)methoxy]phosphonamidic acid |
| SMILES | CC1CCC(C(C)C)C(COP(=O)(O)N(Cc2ccc(C#N)cc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C23H37N2O3P/c1-17(2)22-12-7-18(3)13-21(22)16-28-29(26,27)25(23(4,5)6)15-20-10-8-19(14-24)9-11-20/h8-11,17-18,21-22H,7,12-13,15-16H2,1-6H3,(H,26,27) |
| InChIKey | DQMNTKUSDMEBIR-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|