C18H22O6S — CID 102072633
dimethyl 9-(phenylsulfanylmethyl)-1,4-dioxaspiro[4.4]nonane-7,7-dicarboxylate (PubChem CID 102072633) has the molecular formula C18H22O6S and a molecular weight of 366.44 g/mol. Its IUPAC name is dimethyl 9-(phenylsulfanylmethyl)-1,4-dioxaspiro[4.4]nonane-7,7-dicarboxylate.
| Compound Name | dimethyl 9-(phenylsulfanylmethyl)-1,4-dioxaspiro[4.4]nonane-7,7-dicarboxylate |
|---|---|
| PubChem CID | 102072633 |
| Molecular Formula | C18H22O6S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | dimethyl 9-(phenylsulfanylmethyl)-1,4-dioxaspiro[4.4]nonane-7,7-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(CSc2ccccc2)C2(C1)OCCO2 |
| InChI | InChI=1S/C18H22O6S/c1-21-15(19)17(16(20)22-2)10-13(18(12-17)23-8-9-24-18)11-25-14-6-4-3-5-7-14/h3-7,13H,8-12H2,1-2H3 |
| InChIKey | AQVCVMKFTSAGJU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|