C17H20O5S — CID 11267687
methyl 2-[(3aR,6S,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]-2-phenylsulfanylacetate (PubChem CID 11267687) has the molecular formula C17H20O5S and a molecular weight of 336.41 g/mol. Its IUPAC name is methyl 2-[(3aR,6S,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]-2-phenylsulfanylacetate.
| Compound Name | methyl 2-[(3aR,6S,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]-2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 11267687 |
| Molecular Formula | C17H20O5S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | methyl 2-[(3aR,6S,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]-2-phenylsulfanylacetate |
| SMILES | COC(=O)C(Sc1ccccc1)[C@H]1CC(=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C17H20O5S/c1-17(2)21-13-11(9-12(18)14(13)22-17)15(16(19)20-3)23-10-7-5-4-6-8-10/h4-8,11,13-15H,9H2,1-3H3/t11-,13+,14-,15?/m0/s1 |
| InChIKey | NTWWTHQOWYUBLN-MFLQWKMISA-N |
| XLogP | 2.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |