C15H18O3S — CID 11369464
(3aR,6S,6aR)-2,2-dimethyl-6-(phenylsulfanylmethyl)-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one (PubChem CID 11369464) has the molecular formula C15H18O3S and a molecular weight of 278.37 g/mol. Its IUPAC name is (3aR,6S,6aR)-2,2-dimethyl-6-(phenylsulfanylmethyl)-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one.
| Compound Name | (3aR,6S,6aR)-2,2-dimethyl-6-(phenylsulfanylmethyl)-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 11369464 |
| Molecular Formula | C15H18O3S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | (3aR,6S,6aR)-2,2-dimethyl-6-(phenylsulfanylmethyl)-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](CSc3ccccc3)CC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C15H18O3S/c1-15(2)17-13-10(8-12(16)14(13)18-15)9-19-11-6-4-3-5-7-11/h3-7,10,13-14H,8-9H2,1-2H3/t10-,13-,14+/m1/s1 |
| InChIKey | LDNKQRZLPXOJOF-HONMWMINSA-N |
| XLogP | 2.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |