C18H24O6S — CID 72702730
methyl (3aS,4R,6S,6aR)-2,2-dimethyl-6-[(4-methylphenyl)sulfonylmethyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-4-carboxylate (PubChem CID 72702730) has the molecular formula C18H24O6S and a molecular weight of 368.45 g/mol. Its IUPAC name is methyl (3aS,4R,6S,6aR)-2,2-dimethyl-6-[(4-methylphenyl)sulfonylmethyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-4-carboxylate.
| Compound Name | methyl (3aS,4R,6S,6aR)-2,2-dimethyl-6-[(4-methylphenyl)sulfonylmethyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-4-carboxylate |
|---|---|
| PubChem CID | 72702730 |
| Molecular Formula | C18H24O6S |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | methyl (3aS,4R,6S,6aR)-2,2-dimethyl-6-[(4-methylphenyl)sulfonylmethyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-4-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](CS(=O)(=O)c2ccc(C)cc2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C18H24O6S/c1-11-5-7-13(8-6-11)25(20,21)10-12-9-14(17(19)22-4)16-15(12)23-18(2,3)24-16/h5-8,12,14-16H,9-10H2,1-4H3/t12-,14-,15-,16+/m1/s1 |
| InChIKey | ARRADVPROLNROI-MIGQKNRLSA-N |
| XLogP | 2.10 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |