C19H26O11S2 — CID 23726729
dimethyl 2-[(2R,3S,4S,5R)-2-methoxy-4-(4-methylphenyl)sulfonyl-5-(methylsulfonyloxymethyl)oxolan-3-yl]propanedioate (PubChem CID 23726729) has the molecular formula C19H26O11S2 and a molecular weight of 494.54 g/mol. Its IUPAC name is dimethyl 2-[(2R,3S,4S,5R)-2-methoxy-4-(4-methylphenyl)sulfonyl-5-(methylsulfonyloxymethyl)oxolan-3-yl]propanedioate.
| Compound Name | dimethyl 2-[(2R,3S,4S,5R)-2-methoxy-4-(4-methylphenyl)sulfonyl-5-(methylsulfonyloxymethyl)oxolan-3-yl]propanedioate |
|---|---|
| PubChem CID | 23726729 |
| Molecular Formula | C19H26O11S2 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | dimethyl 2-[(2R,3S,4S,5R)-2-methoxy-4-(4-methylphenyl)sulfonyl-5-(methylsulfonyloxymethyl)oxolan-3-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H]1[C@H](OC)O[C@H](COS(C)(=O)=O)[C@H]1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H26O11S2/c1-11-6-8-12(9-7-11)32(24,25)16-13(10-29-31(5,22)23)30-19(28-4)14(16)15(17(20)26-2)18(21)27-3/h6-9,13-16,19H,10H2,1-5H3/t13-,14-,16-,19-/m1/s1 |
| InChIKey | MMHPDQLGSBXHKM-NPNMTCQASA-N |
| XLogP | 0.06 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|