C18H24O8S — CID 13006760
methyl 2-[(3aR,4R,6S,6aS)-2,2-dimethyl-4-[(4-methylphenyl)sulfonyloxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate (PubChem CID 13006760) has the molecular formula C18H24O8S and a molecular weight of 400.45 g/mol. Its IUPAC name is methyl 2-[(3aR,4R,6S,6aS)-2,2-dimethyl-4-[(4-methylphenyl)sulfonyloxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate.
| Compound Name | methyl 2-[(3aR,4R,6S,6aS)-2,2-dimethyl-4-[(4-methylphenyl)sulfonyloxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate |
|---|---|
| PubChem CID | 13006760 |
| Molecular Formula | C18H24O8S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | methyl 2-[(3aR,4R,6S,6aS)-2,2-dimethyl-4-[(4-methylphenyl)sulfonyloxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@H](COS(=O)(=O)c2ccc(C)cc2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C18H24O8S/c1-11-5-7-12(8-6-11)27(20,21)23-10-14-17-16(25-18(2,3)26-17)13(24-14)9-15(19)22-4/h5-8,13-14,16-17H,9-10H2,1-4H3/t13-,14+,16-,17+/m0/s1 |
| InChIKey | GOOCXQIDQAXQBU-HDEZJCGLSA-N |
| XLogP | 1.55 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|