C20H28O8S — CID 134864878
[(3aS,4S,6aR)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-methylbenzenesulfonate (PubChem CID 134864878) has the molecular formula C20H28O8S and a molecular weight of 428.50 g/mol. Its IUPAC name is [(3aS,4S,6aR)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3aS,4S,6aR)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134864878 |
| Molecular Formula | C20H28O8S |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | [(3aS,4S,6aR)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2O[C@@H]([C@@H]3COC(C)(C)O3)[C@@H]3OC(C)(C)O[C@H]23)cc1 |
| InChI | InChI=1S/C20H28O8S/c1-12-6-8-13(9-7-12)29(21,22)24-11-14-17-18(28-20(4,5)27-17)16(25-14)15-10-23-19(2,3)26-15/h6-9,14-18H,10-11H2,1-5H3/t14?,15-,16-,17+,18-/m0/s1 |
| InChIKey | ZYIRTBDEKFHPNH-GPQQEZGISA-N |
| XLogP | 2.14 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|