C40H52Si — CID 102074673
hex-1-ynyl-[2-(4-pentylphenyl)ethynyl]-phenyl-[2,4,6-tri(propan-2-yl)phenyl]silane (PubChem CID 102074673) has the molecular formula C40H52Si and a molecular weight of 560.94 g/mol. Its IUPAC name is hex-1-ynyl-[2-(4-pentylphenyl)ethynyl]-phenyl-[2,4,6-tri(propan-2-yl)phenyl]silane.
| Compound Name | hex-1-ynyl-[2-(4-pentylphenyl)ethynyl]-phenyl-[2,4,6-tri(propan-2-yl)phenyl]silane |
|---|---|
| PubChem CID | 102074673 |
| Molecular Formula | C40H52Si |
| Molecular Weight | 560.94 g/mol |
| Exact Mass | 560.38 |
| IUPAC Name | hex-1-ynyl-[2-(4-pentylphenyl)ethynyl]-phenyl-[2,4,6-tri(propan-2-yl)phenyl]silane |
| SMILES | CCCCC#C[Si](C#Cc1ccc(CCCCC)cc1)(c1ccccc1)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C40H52Si/c1-9-11-13-18-27-41(37-20-16-14-17-21-37,28-26-35-24-22-34(23-25-35)19-15-12-10-2)40-38(32(5)6)29-36(31(3)4)30-39(40)33(7)8/h14,16-17,20-25,29-33H,9-13,15,19H2,1-8H3 |
| InChIKey | TYXJZWKYMSGFKJ-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.94 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|