C32H36Si — CID 102074670
hex-1-ynyl-(2-phenylethynyl)-bis(2,4,6-trimethylphenyl)silane (PubChem CID 102074670) has the molecular formula C32H36Si and a molecular weight of 448.73 g/mol. Its IUPAC name is hex-1-ynyl-(2-phenylethynyl)-bis(2,4,6-trimethylphenyl)silane.
| Compound Name | hex-1-ynyl-(2-phenylethynyl)-bis(2,4,6-trimethylphenyl)silane |
|---|---|
| PubChem CID | 102074670 |
| Molecular Formula | C32H36Si |
| Molecular Weight | 448.73 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | hex-1-ynyl-(2-phenylethynyl)-bis(2,4,6-trimethylphenyl)silane |
| SMILES | CCCCC#C[Si](C#Cc1ccccc1)(c1c(C)cc(C)cc1C)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C32H36Si/c1-8-9-10-14-18-33(19-17-30-15-12-11-13-16-30,31-26(4)20-24(2)21-27(31)5)32-28(6)22-25(3)23-29(32)7/h11-13,15-16,20-23H,8-10H2,1-7H3 |
| InChIKey | FBIKFAFPYBNUHZ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.73 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|