C13H13IN2O6 — CID 102074792
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(2-iodo-1,3-oxazol-4-yl)-1,3-oxazole-4-carboxylate (PubChem CID 102074792) has the molecular formula C13H13IN2O6 and a molecular weight of 420.16 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(2-iodo-1,3-oxazol-4-yl)-1,3-oxazole-4-carboxylate.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(2-iodo-1,3-oxazol-4-yl)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 102074792 |
| Molecular Formula | C13H13IN2O6 |
| Molecular Weight | 420.16 g/mol |
| Exact Mass | 419.98 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-(2-iodo-1,3-oxazol-4-yl)-1,3-oxazole-4-carboxylate |
| SMILES | CC1(C)OCC(COC(=O)c2coc(-c3coc(I)n3)n2)O1 |
| InChI | InChI=1S/C13H13IN2O6/c1-13(2)21-4-7(22-13)3-19-11(17)9-6-18-10(15-9)8-5-20-12(14)16-8/h5-7H,3-4H2,1-2H3 |
| InChIKey | JFXHZWDESRTMBJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 96.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.16 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|