C17H20O6 — CID 91695344
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 4-(2-methylprop-2-enoyloxy)benzoate (PubChem CID 91695344) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 4-(2-methylprop-2-enoyloxy)benzoate.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 4-(2-methylprop-2-enoyloxy)benzoate |
|---|---|
| PubChem CID | 91695344 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 4-(2-methylprop-2-enoyloxy)benzoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C(=O)OCC2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C17H20O6/c1-11(2)15(18)22-13-7-5-12(6-8-13)16(19)20-9-14-10-21-17(3,4)23-14/h5-8,14H,1,9-10H2,2-4H3 |
| InChIKey | JGDLTHHSPIFTJC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|