C19H24O7 — CID 140908407
[6-[2-(4-hydroxyphenoxy)-2-oxoethyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl 2-methylprop-2-enoate (PubChem CID 140908407) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is [6-[2-(4-hydroxyphenoxy)-2-oxoethyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [6-[2-(4-hydroxyphenoxy)-2-oxoethyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140908407 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [6-[2-(4-hydroxyphenoxy)-2-oxoethyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CC(CC(=O)Oc2ccc(O)cc2)OC(C)(C)O1 |
| InChI | InChI=1S/C19H24O7/c1-12(2)18(22)23-11-16-9-15(25-19(3,4)26-16)10-17(21)24-14-7-5-13(20)6-8-14/h5-8,15-16,20H,1,9-11H2,2-4H3 |
| InChIKey | PMISEKSYXRKCTA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|