C57H72O8 — CID 140869849
[4-[4-[6-[4-[2-[2,2-dimethyl-5-[5-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]pentyl]-1,3-dioxan-4-yl]ethyl]cyclohexyl]hexoxy]phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 140869849) has the molecular formula C57H72O8 and a molecular weight of 885.20 g/mol. Its IUPAC name is [4-[4-[6-[4-[2-[2,2-dimethyl-5-[5-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]pentyl]-1,3-dioxan-4-yl]ethyl]cyclohexyl]hexoxy]phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[6-[4-[2-[2,2-dimethyl-5-[5-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]pentyl]-1,3-dioxan-4-yl]ethyl]cyclohexyl]hexoxy]phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140869849 |
| Molecular Formula | C57H72O8 |
| Molecular Weight | 885.20 g/mol |
| Exact Mass | 884.52 |
| IUPAC Name | [4-[4-[6-[4-[2-[2,2-dimethyl-5-[5-[4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]pentyl]-1,3-dioxan-4-yl]ethyl]cyclohexyl]hexoxy]phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(OCCCCCCC3CCC(CCC4OC(C)(C)OCC4CCCCCOc4ccc(-c5ccc(OC(=O)C(=C)C)cc5)cc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C57H72O8/c1-41(2)55(58)63-52-33-25-47(26-34-52)45-21-29-50(30-22-45)60-38-12-8-7-10-14-43-16-18-44(19-17-43)20-37-54-49(40-62-57(5,6)65-54)15-11-9-13-39-61-51-31-23-46(24-32-51)48-27-35-53(36-28-48)64-56(59)42(3)4/h21-36,43-44,49,54H,1,3,7-20,37-40H2,2,4-6H3 |
| InChIKey | WVMBDIZPLVBJOC-UHFFFAOYSA-N |
| XLogP | 14.31 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.20 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|