C29H40O4Si — CID 140888055
[4-[4-[2-(2,2-ditert-butyl-1,3,2-dioxasilinan-5-yl)ethyl]phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 140888055) has the molecular formula C29H40O4Si and a molecular weight of 480.72 g/mol. Its IUPAC name is [4-[4-[2-(2,2-ditert-butyl-1,3,2-dioxasilinan-5-yl)ethyl]phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[2-(2,2-ditert-butyl-1,3,2-dioxasilinan-5-yl)ethyl]phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140888055 |
| Molecular Formula | C29H40O4Si |
| Molecular Weight | 480.72 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | [4-[4-[2-(2,2-ditert-butyl-1,3,2-dioxasilinan-5-yl)ethyl]phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(CCC3CO[Si](C(C)(C)C)(C(C)(C)C)OC3)cc2)cc1 |
| InChI | InChI=1S/C29H40O4Si/c1-21(2)27(30)33-26-17-15-25(16-18-26)24-13-11-22(12-14-24)9-10-23-19-31-34(32-20-23,28(3,4)5)29(6,7)8/h11-18,23H,1,9-10,19-20H2,2-8H3 |
| InChIKey | FLFFUXAYGNZYMG-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.72 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|