C21H22O6S — CID 135255829
[4-[4-[2-(2,2-dioxo-1,3,2-dioxathian-5-yl)ethyl]phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 135255829) has the molecular formula C21H22O6S and a molecular weight of 402.47 g/mol. Its IUPAC name is [4-[4-[2-(2,2-dioxo-1,3,2-dioxathian-5-yl)ethyl]phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[2-(2,2-dioxo-1,3,2-dioxathian-5-yl)ethyl]phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 135255829 |
| Molecular Formula | C21H22O6S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | [4-[4-[2-(2,2-dioxo-1,3,2-dioxathian-5-yl)ethyl]phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(CCC3COS(=O)(=O)OC3)cc2)cc1 |
| InChI | InChI=1S/C21H22O6S/c1-15(2)21(22)27-20-11-9-19(10-12-20)18-7-5-16(6-8-18)3-4-17-13-25-28(23,24)26-14-17/h5-12,17H,1,3-4,13-14H2,2H3 |
| InChIKey | BZLSETOOBUKFBK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|