C29H17F4NO10S — CID 102075439
2-[2,4,5,7-tetrafluoro-3-(2-nitro-4-propan-2-yloxyphenyl)sulfonyloxy-6-oxoxanthen-9-yl]benzoic acid (PubChem CID 102075439) has the molecular formula C29H17F4NO10S and a molecular weight of 647.51 g/mol. Its IUPAC name is 2-[2,4,5,7-tetrafluoro-3-(2-nitro-4-propan-2-yloxyphenyl)sulfonyloxy-6-oxoxanthen-9-yl]benzoic acid.
| Compound Name | 2-[2,4,5,7-tetrafluoro-3-(2-nitro-4-propan-2-yloxyphenyl)sulfonyloxy-6-oxoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 102075439 |
| Molecular Formula | C29H17F4NO10S |
| Molecular Weight | 647.51 g/mol |
| Exact Mass | 647.05 |
| IUPAC Name | 2-[2,4,5,7-tetrafluoro-3-(2-nitro-4-propan-2-yloxyphenyl)sulfonyloxy-6-oxoxanthen-9-yl]benzoic acid |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)Oc2c(F)cc3c(-c4ccccc4C(=O)O)c4cc(F)c(=O)c(F)c-4oc3c2F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H17F4NO10S/c1-12(2)42-13-7-8-21(20(9-13)34(38)39)45(40,41)44-28-19(31)11-17-22(14-5-3-4-6-15(14)29(36)37)16-10-18(30)25(35)23(32)26(16)43-27(17)24(28)33/h3-12H,1-2H3,(H,36,37) |
| InChIKey | ROABLCVALOUOSO-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 163.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.51 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|