C28H22N2O2S — CID 102076061
(5S,5aS,8aR,8bS)-5-(4-methylphenyl)-2,7-diphenyl-5,5a,8a,8b-tetrahydropyrrolo[3,4-g][1,3]benzothiazole-6,8-dione (PubChem CID 102076061) has the molecular formula C28H22N2O2S and a molecular weight of 450.56 g/mol. Its IUPAC name is (5S,5aS,8aR,8bS)-5-(4-methylphenyl)-2,7-diphenyl-5,5a,8a,8b-tetrahydropyrrolo[3,4-g][1,3]benzothiazole-6,8-dione.
| Compound Name | (5S,5aS,8aR,8bS)-5-(4-methylphenyl)-2,7-diphenyl-5,5a,8a,8b-tetrahydropyrrolo[3,4-g][1,3]benzothiazole-6,8-dione |
|---|---|
| PubChem CID | 102076061 |
| Molecular Formula | C28H22N2O2S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | (5S,5aS,8aR,8bS)-5-(4-methylphenyl)-2,7-diphenyl-5,5a,8a,8b-tetrahydropyrrolo[3,4-g][1,3]benzothiazole-6,8-dione |
| SMILES | Cc1ccc([C@H]2C=C3N=C(c4ccccc4)S[C@H]3[C@H]3C(=O)N(c4ccccc4)C(=O)[C@H]32)cc1 |
| InChI | InChI=1S/C28H22N2O2S/c1-17-12-14-18(15-13-17)21-16-22-25(33-26(29-22)19-8-4-2-5-9-19)24-23(21)27(31)30(28(24)32)20-10-6-3-7-11-20/h2-16,21,23-25H,1H3/t21-,23+,24+,25-/m1/s1 |
| InChIKey | RLUZVQIONNQXLJ-DDKRZIBASA-N |
| XLogP | 5.34 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|