C11H17NO2 — CID 102077042
(4R,9aS)-4-(2-hydroxyethyl)-1,3,4,6,7,9a-hexahydroquinolizin-2-one (PubChem CID 102077042) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (4R,9aS)-4-(2-hydroxyethyl)-1,3,4,6,7,9a-hexahydroquinolizin-2-one.
| Compound Name | (4R,9aS)-4-(2-hydroxyethyl)-1,3,4,6,7,9a-hexahydroquinolizin-2-one |
|---|---|
| PubChem CID | 102077042 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (4R,9aS)-4-(2-hydroxyethyl)-1,3,4,6,7,9a-hexahydroquinolizin-2-one |
| SMILES | O=C1C[C@@H](CCO)N2CCC=C[C@@H]2C1 |
| InChI | InChI=1S/C11H17NO2/c13-6-4-10-8-11(14)7-9-3-1-2-5-12(9)10/h1,3,9-10,13H,2,4-8H2/t9-,10-/m1/s1 |
| InChIKey | UYIFYXIFMYSPNN-NXEZZACHSA-N |
| XLogP | 0.73 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|