C12H18N2O3S — CID 102080126
(4S,5R)-N-benzyl-4-methyl-2,2-dioxooxathiazepan-5-amine (PubChem CID 102080126) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is (4S,5R)-N-benzyl-4-methyl-2,2-dioxooxathiazepan-5-amine.
| Compound Name | (4S,5R)-N-benzyl-4-methyl-2,2-dioxooxathiazepan-5-amine |
|---|---|
| PubChem CID | 102080126 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (4S,5R)-N-benzyl-4-methyl-2,2-dioxooxathiazepan-5-amine |
| SMILES | C[C@@H]1NS(=O)(=O)OCC[C@H]1NCc1ccccc1 |
| InChI | InChI=1S/C12H18N2O3S/c1-10-12(7-8-17-18(15,16)14-10)13-9-11-5-3-2-4-6-11/h2-6,10,12-14H,7-9H2,1H3/t10-,12+/m0/s1 |
| InChIKey | MQGWVGVOTJZVOK-CMPLNLGQSA-N |
| XLogP | 0.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |