C11H16N2O3S — CID 12007757
N-benzyl-2,2-dioxooxathiazepan-5-amine (PubChem CID 12007757) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-benzyl-2,2-dioxooxathiazepan-5-amine.
| Compound Name | N-benzyl-2,2-dioxooxathiazepan-5-amine |
|---|---|
| PubChem CID | 12007757 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | N-benzyl-2,2-dioxooxathiazepan-5-amine |
| SMILES | O=S1(=O)NCC(NCc2ccccc2)CCO1 |
| InChI | InChI=1S/C11H16N2O3S/c14-17(15)13-9-11(6-7-16-17)12-8-10-4-2-1-3-5-10/h1-5,11-13H,6-9H2 |
| InChIKey | BVKVRUFLQVWLFX-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |