C20H16ClNO5S — CID 102081598
dimethyl (2R,10aR)-2-(3-chlorophenyl)-2,10a-dihydro-[1,3]oxazino[2,3-b][1,3]benzothiazole-3,4-dicarboxylate (PubChem CID 102081598) has the molecular formula C20H16ClNO5S and a molecular weight of 417.87 g/mol. Its IUPAC name is dimethyl (2R,10aR)-2-(3-chlorophenyl)-2,10a-dihydro-[1,3]oxazino[2,3-b][1,3]benzothiazole-3,4-dicarboxylate.
| Compound Name | dimethyl (2R,10aR)-2-(3-chlorophenyl)-2,10a-dihydro-[1,3]oxazino[2,3-b][1,3]benzothiazole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 102081598 |
| Molecular Formula | C20H16ClNO5S |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | dimethyl (2R,10aR)-2-(3-chlorophenyl)-2,10a-dihydro-[1,3]oxazino[2,3-b][1,3]benzothiazole-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N2c3ccccc3S[C@H]2O[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H16ClNO5S/c1-25-18(23)15-16(19(24)26-2)22-13-8-3-4-9-14(13)28-20(22)27-17(15)11-6-5-7-12(21)10-11/h3-10,17,20H,1-2H3/t17-,20-/m1/s1 |
| InChIKey | CEQUPRDHXAMGTI-YLJYHZDGSA-N |
| XLogP | 3.91 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |