C14H13NO2S — CID 102081922
6-hydroxy-1,3-dimethyl-5-phenyl-6H-thieno[3,4-c]pyrrol-4-one (PubChem CID 102081922) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is 6-hydroxy-1,3-dimethyl-5-phenyl-6H-thieno[3,4-c]pyrrol-4-one.
| Compound Name | 6-hydroxy-1,3-dimethyl-5-phenyl-6H-thieno[3,4-c]pyrrol-4-one |
|---|---|
| PubChem CID | 102081922 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 6-hydroxy-1,3-dimethyl-5-phenyl-6H-thieno[3,4-c]pyrrol-4-one |
| SMILES | Cc1sc(C)c2c1C(=O)N(c1ccccc1)C2O |
| InChI | InChI=1S/C14H13NO2S/c1-8-11-12(9(2)18-8)14(17)15(13(11)16)10-6-4-3-5-7-10/h3-7,13,16H,1-2H3 |
| InChIKey | ABWDVJPIYUMGKL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |