C15H22O — CID 102082547
2,3-dideuterio-1-phenylnonan-1-one (PubChem CID 102082547) has the molecular formula C15H22O and a molecular weight of 220.35 g/mol. Its IUPAC name is 2,3-dideuterio-1-phenylnonan-1-one.
| Compound Name | 2,3-dideuterio-1-phenylnonan-1-one |
|---|---|
| PubChem CID | 102082547 |
| Molecular Formula | C15H22O |
| Molecular Weight | 220.35 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 2,3-dideuterio-1-phenylnonan-1-one |
| SMILES | [2H]C(CCCCCC)C([2H])C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H22O/c1-2-3-4-5-6-10-13-15(16)14-11-8-7-9-12-14/h7-9,11-12H,2-6,10,13H2,1H3/i10D,13D |
| InChIKey | PFUPABFCHVRLLY-JVWQUBBQSA-N |
| XLogP | 4.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|