C21H30NO12P — CID 102083096
[(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(dimethoxyphosphorylamino)-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate (PubChem CID 102083096) has the molecular formula C21H30NO12P and a molecular weight of 519.44 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(dimethoxyphosphorylamino)-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(dimethoxyphosphorylamino)-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102083096 |
| Molecular Formula | C21H30NO12P |
| Molecular Weight | 519.44 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(dimethoxyphosphorylamino)-6-(4-methoxyphenoxy)oxan-2-yl]methyl acetate |
| SMILES | COc1ccc(O[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2NP(=O)(OC)OC)cc1 |
| InChI | InChI=1S/C21H30NO12P/c1-12(23)30-11-17-19(31-13(2)24)20(32-14(3)25)18(22-35(26,28-5)29-6)21(34-17)33-16-9-7-15(27-4)8-10-16/h7-10,17-21H,11H2,1-6H3,(H,22,26)/t17-,18-,19-,20-,21-/m1/s1 |
| InChIKey | BASFCNUDSAXNCI-PFAUGDHASA-N |
| XLogP | 1.58 |
| TPSA | 154.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|