C28H29Cl2NO5 — CID 10208686
5-chloro-3-[2-chloro-5-(2-methoxyethoxymethyl)phenyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-methylindol-2-one (PubChem CID 10208686) has the molecular formula C28H29Cl2NO5 and a molecular weight of 530.45 g/mol. Its IUPAC name is 5-chloro-3-[2-chloro-5-(2-methoxyethoxymethyl)phenyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-methylindol-2-one.
| Compound Name | 5-chloro-3-[2-chloro-5-(2-methoxyethoxymethyl)phenyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-methylindol-2-one |
|---|---|
| PubChem CID | 10208686 |
| Molecular Formula | C28H29Cl2NO5 |
| Molecular Weight | 530.45 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 5-chloro-3-[2-chloro-5-(2-methoxyethoxymethyl)phenyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-methylindol-2-one |
| SMILES | COCCOCc1ccc(Cl)c(C2(C)C(=O)N(Cc3ccc(OC)cc3OC)c3ccc(Cl)cc32)c1 |
| InChI | InChI=1S/C28H29Cl2NO5/c1-28(22-13-18(5-9-24(22)30)17-36-12-11-33-2)23-14-20(29)7-10-25(23)31(27(28)32)16-19-6-8-21(34-3)15-26(19)35-4/h5-10,13-15H,11-12,16-17H2,1-4H3 |
| InChIKey | SINJMAOFDXSCKM-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.45 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|