C31H34Cl2N2O5 — CID 10303809
5-chloro-3-[2-chloro-5-(2-morpholin-4-ylethoxymethyl)phenyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-methylindol-2-one (PubChem CID 10303809) has the molecular formula C31H34Cl2N2O5 and a molecular weight of 585.53 g/mol. Its IUPAC name is 5-chloro-3-[2-chloro-5-(2-morpholin-4-ylethoxymethyl)phenyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-methylindol-2-one.
| Compound Name | 5-chloro-3-[2-chloro-5-(2-morpholin-4-ylethoxymethyl)phenyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-methylindol-2-one |
|---|---|
| PubChem CID | 10303809 |
| Molecular Formula | C31H34Cl2N2O5 |
| Molecular Weight | 585.53 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | 5-chloro-3-[2-chloro-5-(2-morpholin-4-ylethoxymethyl)phenyl]-1-[(2,4-dimethoxyphenyl)methyl]-3-methylindol-2-one |
| SMILES | COc1ccc(CN2C(=O)C(C)(c3cc(COCCN4CCOCC4)ccc3Cl)c3cc(Cl)ccc32)c(OC)c1 |
| InChI | InChI=1S/C31H34Cl2N2O5/c1-31(25-16-21(4-8-27(25)33)20-40-15-12-34-10-13-39-14-11-34)26-17-23(32)6-9-28(26)35(30(31)36)19-22-5-7-24(37-2)18-29(22)38-3/h4-9,16-18H,10-15,19-20H2,1-3H3 |
| InChIKey | IEGUGOVZQRGHJA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|