C30H32Cl2N2O5 — CID 91108844
4-chloro-3-[2-[5-chloro-1-[(2,4-dimethoxyphenyl)methyl]-3-methyl-2-oxoindol-3-yl]ethyl]-N-(2-methoxyethyl)benzamide (PubChem CID 91108844) has the molecular formula C30H32Cl2N2O5 and a molecular weight of 571.50 g/mol. Its IUPAC name is 4-chloro-3-[2-[5-chloro-1-[(2,4-dimethoxyphenyl)methyl]-3-methyl-2-oxoindol-3-yl]ethyl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-chloro-3-[2-[5-chloro-1-[(2,4-dimethoxyphenyl)methyl]-3-methyl-2-oxoindol-3-yl]ethyl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 91108844 |
| Molecular Formula | C30H32Cl2N2O5 |
| Molecular Weight | 571.50 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | 4-chloro-3-[2-[5-chloro-1-[(2,4-dimethoxyphenyl)methyl]-3-methyl-2-oxoindol-3-yl]ethyl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(Cl)c(CCC2(C)C(=O)N(Cc3ccc(OC)cc3OC)c3ccc(Cl)cc32)c1 |
| InChI | InChI=1S/C30H32Cl2N2O5/c1-30(12-11-19-15-20(6-9-25(19)32)28(35)33-13-14-37-2)24-16-22(31)7-10-26(24)34(29(30)36)18-21-5-8-23(38-3)17-27(21)39-4/h5-10,15-17H,11-14,18H2,1-4H3,(H,33,35) |
| InChIKey | DNNBWNXGLRFJJQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|