C21H28O2Si — CID 102088595
(2S)-2,3-diphenyl-2-triethylsilyloxypropanal (PubChem CID 102088595) has the molecular formula C21H28O2Si and a molecular weight of 340.54 g/mol. Its IUPAC name is (2S)-2,3-diphenyl-2-triethylsilyloxypropanal.
| Compound Name | (2S)-2,3-diphenyl-2-triethylsilyloxypropanal |
|---|---|
| PubChem CID | 102088595 |
| Molecular Formula | C21H28O2Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (2S)-2,3-diphenyl-2-triethylsilyloxypropanal |
| SMILES | CC[Si](CC)(CC)O[C@@](C=O)(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28O2Si/c1-4-24(5-2,6-3)23-21(18-22,20-15-11-8-12-16-20)17-19-13-9-7-10-14-19/h7-16,18H,4-6,17H2,1-3H3/t21-/m1/s1 |
| InChIKey | MGPQMUVONHBLEN-OAQYLSRUSA-N |
| XLogP | 5.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|