C15H20O3 — CID 102089082
(3'aR,5'aS)-spiro[1,3-dioxane-5,7'-2,3,3a,4,5,5a,6,8-octahydro-as-indacene]-1'-one (PubChem CID 102089082) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (3'aR,5'aS)-spiro[1,3-dioxane-5,7'-2,3,3a,4,5,5a,6,8-octahydro-as-indacene]-1'-one.
| Compound Name | (3'aR,5'aS)-spiro[1,3-dioxane-5,7'-2,3,3a,4,5,5a,6,8-octahydro-as-indacene]-1'-one |
|---|---|
| PubChem CID | 102089082 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (3'aR,5'aS)-spiro[1,3-dioxane-5,7'-2,3,3a,4,5,5a,6,8-octahydro-as-indacene]-1'-one |
| SMILES | O=C1CC[C@H]2CC[C@H]3CC4(COCOC4)CC3=C12 |
| InChI | InChI=1S/C15H20O3/c16-13-4-3-10-1-2-11-5-15(6-12(11)14(10)13)7-17-9-18-8-15/h10-11H,1-9H2/t10-,11+/m1/s1 |
| InChIKey | QTZINSXPNBVIRR-MNOVXSKESA-N |
| XLogP | 2.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |