C14H20O3 — CID 11459011
2,2,3'-trimethylspiro[1,3-dioxane-5,5'-1,4,6,6a-tetrahydropentalene]-2'-one (PubChem CID 11459011) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2,2,3'-trimethylspiro[1,3-dioxane-5,5'-1,4,6,6a-tetrahydropentalene]-2'-one.
| Compound Name | 2,2,3'-trimethylspiro[1,3-dioxane-5,5'-1,4,6,6a-tetrahydropentalene]-2'-one |
|---|---|
| PubChem CID | 11459011 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 2,2,3'-trimethylspiro[1,3-dioxane-5,5'-1,4,6,6a-tetrahydropentalene]-2'-one |
| SMILES | CC1=C2CC3(COC(C)(C)OC3)CC2CC1=O |
| InChI | InChI=1S/C14H20O3/c1-9-11-6-14(5-10(11)4-12(9)15)7-16-13(2,3)17-8-14/h10H,4-8H2,1-3H3 |
| InChIKey | JZGGFDAAHLUWBO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |