C17H26O3 — CID 135020344
3'-butyl-2,2-dimethylspiro[1,3-dioxane-5,5'-1,4,6,6a-tetrahydropentalene]-2'-one (PubChem CID 135020344) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 3'-butyl-2,2-dimethylspiro[1,3-dioxane-5,5'-1,4,6,6a-tetrahydropentalene]-2'-one.
| Compound Name | 3'-butyl-2,2-dimethylspiro[1,3-dioxane-5,5'-1,4,6,6a-tetrahydropentalene]-2'-one |
|---|---|
| PubChem CID | 135020344 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 3'-butyl-2,2-dimethylspiro[1,3-dioxane-5,5'-1,4,6,6a-tetrahydropentalene]-2'-one |
| SMILES | CCCCC1=C2CC3(COC(C)(C)OC3)CC2CC1=O |
| InChI | InChI=1S/C17H26O3/c1-4-5-6-13-14-9-17(8-12(14)7-15(13)18)10-19-16(2,3)20-11-17/h12H,4-11H2,1-3H3 |
| InChIKey | CNOFGZUUHWDTCZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |