C18H26O5 — CID 10245573
diethyl 6-butyl-5-oxo-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate (PubChem CID 10245573) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is diethyl 6-butyl-5-oxo-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate.
| Compound Name | diethyl 6-butyl-5-oxo-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 10245573 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | diethyl 6-butyl-5-oxo-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
| SMILES | CCCCC1=C2CC(C(=O)OCC)(C(=O)OCC)CC2CC1=O |
| InChI | InChI=1S/C18H26O5/c1-4-7-8-13-14-11-18(16(20)22-5-2,17(21)23-6-3)10-12(14)9-15(13)19/h12H,4-11H2,1-3H3 |
| InChIKey | IHVCPTNYLZHQFR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|