C17H24O5 — CID 15249487
diethyl (3aS)-5-oxo-6-propyl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate (PubChem CID 15249487) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is diethyl (3aS)-5-oxo-6-propyl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate.
| Compound Name | diethyl (3aS)-5-oxo-6-propyl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 15249487 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | diethyl (3aS)-5-oxo-6-propyl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
| SMILES | CCCC1=C2CC(C(=O)OCC)(C(=O)OCC)C[C@H]2CC1=O |
| InChI | InChI=1S/C17H24O5/c1-4-7-12-13-10-17(15(19)21-5-2,16(20)22-6-3)9-11(13)8-14(12)18/h11H,4-10H2,1-3H3/t11-/m1/s1 |
| InChIKey | NNGNYVRAIYKCNK-LLVKDONJSA-N |
| XLogP | 2.58 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|