C17H24O5 — CID 10566744
diethyl 5-oxo-6-propan-2-yl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate (PubChem CID 10566744) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is diethyl 5-oxo-6-propan-2-yl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate.
| Compound Name | diethyl 5-oxo-6-propan-2-yl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 10566744 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | diethyl 5-oxo-6-propan-2-yl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=C(C(C)C)C(=O)CC2C1 |
| InChI | InChI=1S/C17H24O5/c1-5-21-15(19)17(16(20)22-6-2)8-11-7-13(18)14(10(3)4)12(11)9-17/h10-11H,5-9H2,1-4H3 |
| InChIKey | CRKOMACGLWCUDX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|