C13H18O3 — CID 11401794
5,5-dimethylspiro[1,3-dioxane-2,5'-1,4,6,6a-tetrahydropentalene]-2'-one (PubChem CID 11401794) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 5,5-dimethylspiro[1,3-dioxane-2,5'-1,4,6,6a-tetrahydropentalene]-2'-one.
| Compound Name | 5,5-dimethylspiro[1,3-dioxane-2,5'-1,4,6,6a-tetrahydropentalene]-2'-one |
|---|---|
| PubChem CID | 11401794 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 5,5-dimethylspiro[1,3-dioxane-2,5'-1,4,6,6a-tetrahydropentalene]-2'-one |
| SMILES | CC1(C)COC2(CC3=CC(=O)CC3C2)OC1 |
| InChI | InChI=1S/C13H18O3/c1-12(2)7-15-13(16-8-12)5-9-3-11(14)4-10(9)6-13/h3,10H,4-8H2,1-2H3 |
| InChIKey | URMFISUYKZWIRZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |